188561-56-0 Usage
Uses
Used in Pharmaceutical Drug Production:
METHYL 2-ACETYLAMINO-3-DIMETHYLAMINOPROPENOATE is used as a key component in the synthesis of various pharmaceutical drugs. Its unique structure and properties enable the development of innovative and effective medications for a wide range of medical conditions.
Used in Organic Synthesis as a Chemical Intermediate:
In the field of organic synthesis, METHYL 2-ACETYLAMINO-3-DIMETHYLAMINOPROPENOATE is utilized as a chemical intermediate, contributing to the formation of complex organic compounds. Its presence in the synthesis process allows for the creation of a diverse range of organic molecules with potential applications in various industries.
Used in Laboratory Research and Drug Development:
METHYL 2-ACETYLAMINO-3-DIMETHYLAMINOPROPENOATE plays a significant role in laboratory research and drug development. Its unique properties make it an essential building block for the creation of new pharmaceutical products and organic compounds, driving advancements in scientific research and the development of novel therapeutic agents.
Used in the Creation of Peptide Molecules and Bioactive Organic Compounds:
This synthetic compound is employed as a precursor in the synthesis of peptide molecules and other bioactive organic compounds. Its versatile nature allows for the development of innovative and effective compounds with potential applications in various fields, including medicine, agriculture, and environmental science.
Check Digit Verification of cas no
The CAS Registry Mumber 188561-56-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,5,6 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 188561-56:
(8*1)+(7*8)+(6*8)+(5*5)+(4*6)+(3*1)+(2*5)+(1*6)=180
180 % 10 = 0
So 188561-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2O3/c1-6(11)9-7(5-10(2)3)8(12)13-4/h5H,1-4H3,(H,9,11)
188561-56-0Relevant academic research and scientific papers
Route development and multikilogram GMP delivery of a somatostatin receptor antagonist
Ruck, Rebecca T.,Huffman, Mark A.,Stewart, Gavin W.,Cleator, Ed,Kandur, Wynne V.,Kim, Mary M.,Zhao, Dalian
, p. 1329 - 1337 (2012/10/29)
Route development and demonstration on multikilogram scale for the first GMP delivery of MK-4256 are described. Key aspects of the convergent route include a regioselective green iodination, one-pot oxadiazole synthesis, and an efficient ketone Pictet-Spengler reaction with diastereomeric upgrade via crystallization to afford 6 kg of API. A recycle procedure augmented the yield of desired diastereomer in the Pictet-Spengler reaction from a mixture of diastereomers heavily enriched in the undesired diastereomer.
