18964-31-3 Usage
Uses
Used in Industrial Processes:
2,3-dichloro-5-(dichloromethylidene)cyclopent-2-ene-1,4-dione is used as a solvent in various industrial applications due to its ability to dissolve a wide range of substances. Its solubility properties make it a valuable component in the production of certain materials and chemicals.
Used in Pesticide and Herbicide Production:
2,3-dichloro-5-(dichloromethylidene)cyclopent-2-ene-1,4-dione is utilized in the synthesis of pesticides and herbicides, contributing to its agricultural applications. Its reactivity and ability to form various chemical structures enable the development of effective crop protection products.
Used in Organic Synthesis:
2,3-dichloro-5-(dichloromethylidene)cyclopent-2-ene-1,4-dione is employed as a key intermediate in the synthesis of other organic compounds. Its high reactivity allows chemists to create a diverse array of molecules, which can be further used in pharmaceuticals, materials science, and other fields.
Check Digit Verification of cas no
The CAS Registry Mumber 18964-31-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,9,6 and 4 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 18964-31:
(7*1)+(6*8)+(5*9)+(4*6)+(3*4)+(2*3)+(1*1)=143
143 % 10 = 3
So 18964-31-3 is a valid CAS Registry Number.
InChI:InChI=1/C6Cl4O2/c7-2-3(8)5(12)1(4(2)11)6(9)10
