190271-88-6 Usage
Uses
Used in Pharmaceutical Research and Synthesis:
2-CHLORO-5-NITRONICOTINIC ACID METHYL ESTER is used as a building block for the development of various pharmaceuticals. Its unique structure and functional groups make it a valuable component in the synthesis of new drug candidates.
Used in Agrochemical Development:
In the agrochemical industry, 2-CHLORO-5-NITRONICOTINIC ACID METHYL ESTER is used as a key intermediate in the synthesis of various agrochemicals. Its potential as an antifungal and antibacterial agent makes it a promising candidate for the development of new pesticides and other agricultural chemicals.
Used in Organic Chemistry:
2-CHLORO-5-NITRONICOTINIC ACID METHYL ESTER is an important chemical reagent in the field of organic chemistry. Its versatile structure allows for various chemical reactions and transformations, making it a valuable tool for the synthesis of complex organic compounds.
Used in the Synthesis of Heterocyclic Compounds:
2-CHLORO-5-NITRONICOTINIC ACID METHYL ESTER is used as a key intermediate in the synthesis of heterocyclic compounds. Its unique properties and reactivity make it an essential component in the preparation of various heterocyclic structures, which are widely found in pharmaceuticals, agrochemicals, and other organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 190271-88-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,0,2,7 and 1 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 190271-88:
(8*1)+(7*9)+(6*0)+(5*2)+(4*7)+(3*1)+(2*8)+(1*8)=136
136 % 10 = 6
So 190271-88-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2O4/c1-14-7(11)5-2-4(10(12)13)3-9-6(5)8/h2-3H,1H3
190271-88-6Relevant academic research and scientific papers
MEDIATORS OF HEDGEHOG SIGNALING PATHWAYS, COMPOSITIONS AND USES RELATED THERETO
-
Page/Page column 124-125, (2008/06/13)
The present invention makes available methods and reagents for inhibiting aberrant growth states resulting from hedgehog gain-of-function, ptc loss-of-function or smoothened gain-of-function comprising contacting the cell with a hedgehog antagonist of formula (I) in a sufficient amount to aberrant growth state, e.g., to agonize a normal ptc pathway or antagonize smoothened or hedgehog activity.
Inhibitors of protein tyrosine phosphatase 1B
-
Page/Page column 9; 26, (2008/06/13)
Protein tyrosine phosphatases (PTPases) such as PTP1B can play a role in regulating a wide variety of cellular responses such as insulin signaling. Substituted bicyclic fused-thiophene compounds can inhibit PTP1B and thereby induce greater insulin sensitivity. Accordingly, PTP1B inhibition can provide an alternate treatment for PTPase-mediated disorders such as diabetes.
