19029-66-4 Usage
Chemical compound
1-Aminoinosine is a chemical compound derived from inosine, a nucleoside involved in the formation of nucleic acids.
Purine nucleotide analogue
It is a purine nucleotide analogue, which means it is structurally similar to naturally occurring purine nucleotides.
Antiviral properties
1-Aminoinosine has been studied for its potential antiviral properties, specifically as an inhibitor of viral RNA synthesis.
Anticancer properties
It has also shown promise in inhibiting the growth of cancer cells, making it a potential candidate for cancer therapy.
Potential applications
Further research is needed to fully understand the mechanisms and potential applications of 1-Aminoinosine in the field of medicine.
Development of antiviral medications
1-Aminoinosine's ability to inhibit viral RNA synthesis makes it a potential candidate for the development of antiviral medications.
Inhibitor of viral RNA synthesis
1-Aminoinosine has been identified as a potential inhibitor of viral RNA synthesis, which could help in the development of antiviral drugs.
Inhibitor of cancer cell growth
The compound has shown some promise in inhibiting the growth of cancer cells, indicating its potential use in cancer therapy.
Nucleic acid formation
As a derivative of inosine, 1-Aminoinosine is involved in the formation of nucleic acids, which are essential for the storage and transmission of genetic information in living organisms.
Further research
More research is required to explore the full potential and mechanisms of action of 1-Aminoinosine in medicine, particularly in the development of antiviral and anticancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 19029-66-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,0,2 and 9 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19029-66:
(7*1)+(6*9)+(5*0)+(4*2)+(3*9)+(2*6)+(1*6)=114
114 % 10 = 4
So 19029-66-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N5O5/c11-15-3-13-8-5(9(15)19)12-2-14(8)10-7(18)6(17)4(1-16)20-10/h2-4,6-7,10,16-18H,1,11H2
