19198-88-0 Usage
Uses
Used in Pharmaceutical Synthesis:
1-BROMO-4-METHYL-3-HEXENE is used as an intermediate for the synthesis of various pharmaceuticals, contributing to the development of new medications and therapies.
Used in Agrochemical Production:
In the agrochemical industry, 1-BROMO-4-METHYL-3-HEXENE serves as a key intermediate, playing a crucial role in the production of crop protection agents and other agricultural products.
Used in Organic Chemistry as a Reagent:
1-BROMO-4-METHYL-3-HEXENE is utilized as a reagent in organic chemistry reactions, particularly for the formation of carbon-carbon bonds, which are essential in creating complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 19198-88-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,1,9 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 19198-88:
(7*1)+(6*9)+(5*1)+(4*9)+(3*8)+(2*8)+(1*8)=150
150 % 10 = 0
So 19198-88-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H13Br/c1-3-7(2)5-4-6-8/h5H,3-4,6H2,1-2H3/b7-5+
