194470-10-5 Usage
Uses
Used in Pharmaceutical Synthesis:
9-Fluorenone-1-boronic acid serves as a key building block in the creation of various pharmaceuticals. Its unique reactivity allows for the development of new drug molecules, contributing to advancements in medicinal chemistry.
Used in Organic Chemistry:
As a versatile intermediate, 9-Fluorenone-1-boronic acid is utilized in organic chemistry for its role in forming essential carbon-carbon and carbon-oxygen bonds. This capability is crucial for the synthesis of complex organic compounds.
Used in Medicinal Chemistry:
9-FLUORENONE-1-BORONIC ACID's potential in medicinal chemistry is attributed to its capacity to enhance the properties of drug candidates, making it an indispensable tool in the design and synthesis of novel therapeutic agents.
Used in Research and Development:
9-Fluorenone-1-boronic acid is also employed in research and development settings to explore new reaction pathways and to understand the mechanisms of complex chemical transformations, thereby expanding the horizons of chemical knowledge and application.
Check Digit Verification of cas no
The CAS Registry Mumber 194470-10-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,4,4,7 and 0 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 194470-10:
(8*1)+(7*9)+(6*4)+(5*4)+(4*7)+(3*0)+(2*1)+(1*0)=145
145 % 10 = 5
So 194470-10-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H9BO3/c15-13-10-5-2-1-4-8(10)9-6-3-7-11(12(9)13)14(16)17/h1-7,16-17H
194470-10-5Relevant academic research and scientific papers
Demeter, Attila,Timari, Geza,Kotschy, Andras,Berces, Tibor
, p. 5219 - 5222 (1997)
1-aryl-fluorenone derivatives were prepared from fluorenone via 9- fluorenone-1-boronic acid by coupling with the corresponding aryl-halides. The photophysical properties of these derivatives were found to be strongly influenced by a new CT transition, resulting in some cases in dual luminescence.
Transition metal complex and organic electronic device thereof
-
Paragraph 0211-0215, (2020/05/29)
The invention discloses a transition metal complex and an organic electronic device thereof. The structure of the transition metal complex is shown as a chemical formula (1). The transition metal complex is used as a light-emitting layer doping material of an organic electronic device, and can improve the light-emitting efficiency and prolong the service life of the device.
