195191-47-0 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-4-chloro-6-fluoroaniline is used as a chemical intermediate for the preparation of fragment A of an orally bioavailable and CNS penetrant bradykinin1 antagonist. This application is significant because it targets the development of drugs that can effectively cross the blood-brain barrier and provide relief for conditions related to the central nervous system.
The unique structural features of 2-Bromo-4-chloro-6-fluoroaniline, including the presence of multiple halogens, make it a valuable compound for further chemical modifications and the synthesis of more complex molecules with potential therapeutic properties. Its use in the pharmaceutical industry highlights the importance of understanding the chemical properties and reactivity of such compounds in drug discovery and development processes.
Check Digit Verification of cas no
The CAS Registry Mumber 195191-47-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,5,1,9 and 1 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 195191-47:
(8*1)+(7*9)+(6*5)+(5*1)+(4*9)+(3*1)+(2*4)+(1*7)=160
160 % 10 = 0
So 195191-47-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrClFN/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2