19579-44-3 Usage
Uses
1. Used in Pharmaceutical Industry:
1-(2-Chlorophenyl)biguanide hydrochloride is used as a chemical intermediate for the synthesis of various pharmaceutical compounds, particularly those with antidiabetic and antimalarial properties. Its presence of a chlorophenyl and biguanide group makes it a promising candidate for the development of new drugs with improved efficacy and reduced side effects.
2. Used in Chemical Research:
1-(2-Chlorophenyl)biguanide hydrochloride serves as a starting material for chemical research and development, allowing scientists to explore its potential applications and properties. Its unique structure and the presence of a chlorophenyl group make it an interesting subject for further investigation in the field of organic chemistry.
3. Used in Drug Synthesis:
1-(2-Chlorophenyl)biguanide hydrochloride is used as a key component in the synthesis of new drugs, particularly those targeting diabetes and malaria. Its chemical properties and reactivity can be leveraged to create novel compounds with enhanced therapeutic effects and reduced side effects.
4. Used in Pesticide Industry:
Although not widely documented, 1-(2-Chlorophenyl)biguanide hydrochloride may also have potential applications in the pesticide industry due to its organochlorine nature. Its chemical properties could be utilized to develop new pesticides with improved effectiveness and reduced environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 19579-44-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,5,7 and 9 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 19579-44:
(7*1)+(6*9)+(5*5)+(4*7)+(3*9)+(2*4)+(1*4)=153
153 % 10 = 3
So 19579-44-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN5/c9-5-3-1-2-4-6(5)13-8(12)14-7(10)11/h1-4H,(H6,10,11,12,13,14)/p+2
