19585-90-1 Usage
General Description
3-Phenylquinoline-2,4-dicarboxylic acid, also known as PQDCA, is a chemical compound with potential pharmacological and medicinal properties. It is a derivative of quinoline and is commonly used in the synthesis of various organic compounds. PQDCA has been studied for its potential anti-inflammatory and antioxidant activities, as well as its ability to inhibit the growth of certain cancer cells. It is also being investigated for its potential use in the treatment of neurodegenerative diseases such as Alzheimer's and Parkinson's. Additionally, PQDCA has shown promise as a potential drug candidate for the treatment of various other medical conditions, making it a compound of interest for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 19585-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,5,8 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 19585-90:
(7*1)+(6*9)+(5*5)+(4*8)+(3*5)+(2*9)+(1*0)=151
151 % 10 = 1
So 19585-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H11NO4/c19-16(20)14-11-8-4-5-9-12(11)18-15(17(21)22)13(14)10-6-2-1-3-7-10/h1-9H,(H,19,20)(H,21,22)