19585-90-1 Usage
Uses
Used in Pharmaceutical Industry:
3-Phenylquinoline-2,4-dicarboxylic acid is used as a potential drug candidate for the treatment of various medical conditions, including neurodegenerative diseases such as Alzheimer's and Parkinson's, due to its potential pharmacological and medicinal properties.
Used in Cancer Treatment:
3-Phenylquinoline-2,4-dicarboxylic acid is used as an anti-cancer agent for inhibiting the growth of certain cancer cells, making it a promising compound for further research and development in oncology.
Used in Organic Synthesis:
3-Phenylquinoline-2,4-dicarboxylic acid is used as a key intermediate in the synthesis of various organic compounds, contributing to the development of new pharmaceuticals and other chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 19585-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,5,8 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 19585-90:
(7*1)+(6*9)+(5*5)+(4*8)+(3*5)+(2*9)+(1*0)=151
151 % 10 = 1
So 19585-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H11NO4/c19-16(20)14-11-8-4-5-9-12(11)18-15(17(21)22)13(14)10-6-2-1-3-7-10/h1-9H,(H,19,20)(H,21,22)
