197237-97-1 Usage
Uses
Used in Pharmaceutical Industry:
4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-carbaldehyde is used as a key intermediate in the synthesis of pharmaceutical compounds. Its reactivity allows for the formation of various functional groups, enabling the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carbaldehyde serves as a precursor for the synthesis of agrochemicals, such as pesticides and herbicides. Its unique structure and reactivity contribute to the development of more effective and environmentally friendly agrochemical products.
Used in Organic Synthesis:
4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-carbaldehyde is used as a building block for the synthesis of more complex organic molecules. Its high reactivity allows for the formation of various functional groups, facilitating the creation of novel compounds with potential applications in various fields, such as materials science, pharmaceuticals, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 197237-97-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,7,2,3 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 197237-97:
(8*1)+(7*9)+(6*7)+(5*2)+(4*3)+(3*7)+(2*9)+(1*7)=181
181 % 10 = 1
So 197237-97-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NOS/c10-5-7-3-6-4-9-2-1-8(6)11-7/h3,5,9H,1-2,4H2
197237-97-1Relevant academic research and scientific papers
Process for preparing 6-alkylidene penem derivatives
-
, (2008/06/13)
The present invention provides a process of making compounds of formula I, which are useful for the treatment of bacterial infection or disease.
