199725-38-7 Usage
Description
Ethyl cis-1,3,4,4a,5,9b-hexahydro-2H-pyrido[4,3-b]indole-2-carboxylate is a complex ester compound with potential medicinal properties, commonly utilized in the fields of organic chemistry and pharmaceuticals. Its unique structure and pharmacological activities, such as anti-inflammatory, analgesic, or sedative effects, make it a valuable compound for research and therapeutic applications.
Uses
Used in Pharmaceutical Industry:
Ethyl cis-1,3,4,4a,5,9b-hexahydro-2H-pyrido[4,3-b]indole-2-carboxylate is used as a pharmaceutical agent for its potential to exhibit anti-inflammatory, analgesic, or sedative effects. Its unique structure and pharmacological properties make it a promising candidate for the development of new drugs targeting various medical conditions.
Used in Organic Chemistry Research:
In the field of organic chemistry, Ethyl cis-1,3,4,4a,5,9b-hexahydro-2H-pyrido[4,3-b]indole-2-carboxylate serves as an important compound for research. Its complex structure and potential medicinal properties provide a foundation for exploring new chemical reactions, synthesis methods, and applications in the development of novel organic compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 199725-38-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,9,7,2 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 199725-38:
(8*1)+(7*9)+(6*9)+(5*7)+(4*2)+(3*5)+(2*3)+(1*8)=197
197 % 10 = 7
So 199725-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H18N2O2/c1-2-18-14(17)16-8-7-13-11(9-16)10-5-3-4-6-12(10)15-13/h3-6,11,13,15H,2,7-9H2,1H3/t11-,13-/m1/s1
199725-38-7Relevant articles and documents
Hexahydro-pyrido(4,3-b)indole derivatives as antipsychotic drugs
-
, (2008/06/13)
PCT No. PCT/EP97/02710 Sec. 371 Date Nov. 9, 1998 Sec. 102(e) Date Nov. 9, 1998 PCT Filed May 15, 1997 PCT Pub. No. WO97/44040 PCT Pub. Date Nov. 27, 1997This invention concerns the compounds of formula the pharmaceutically acceptable addition salts and t