20090-58-8 Usage
General Description
2-Pyrimidinamine, 4-chloro-5-methyl- (9CI) is a chemical compound with the molecular formula C5H6ClN3. It is a derivative of pyrimidinamine and is characterized by a chlorine atom at position 4 and a methyl group at position 5. 2-Pyrimidinamine, 4-chloro-5-methyl- (9CI) has potential applications in pharmaceutical and agricultural industries, where it can be used as a building block in the synthesis of various compounds. Its specific properties and potential uses in various industries make it a valuable compound for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 20090-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,0,9 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 20090-58:
(7*2)+(6*0)+(5*0)+(4*9)+(3*0)+(2*5)+(1*8)=68
68 % 10 = 8
So 20090-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H6ClN3/c1-3-2-8-5(7)9-4(3)6/h2H,1H3,(H2,7,8,9)
20090-58-8Relevant articles and documents
NOVEL COMPOUNDS
-
Page 31-33, (2010/02/08)
The invention relates to pyridine derivatives of formula (I) where the variables are defined in the specification.Processes for the preparation of these compounds together with pharmaceutical compositions containing them and their use in therapy in particular in the modulation of autoimmune disease is also described.
