2016-05-9 Usage
Uses
Used in Pharmaceutical and Chemical Industries:
N,N-Dimethylformamide dicyclohexyl acetal is used as a protective group reagent for the protection of reactive functional groups in organic synthesis. It plays a crucial role in preventing unwanted reactions, ensuring the successful synthesis of complex organic molecules.
Used as a Solvent in Organic Reactions:
In the realm of organic chemistry, N,N-Dimethylformamide dicyclohexyl acetal is employed as a solvent for various organic reactions. Its properties make it suitable for facilitating a wide range of chemical processes.
Used as a Stabilizer for Certain Compounds:
Beyond its role as a reagent and solvent, N,N-Dimethylformamide dicyclohexyl acetal also functions as a stabilizer for specific compounds. This application underscores its versatility and importance in maintaining the integrity and stability of certain chemical entities in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2016-05-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,1 and 6 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2016-05:
(6*2)+(5*0)+(4*1)+(3*6)+(2*0)+(1*5)=39
39 % 10 = 9
So 2016-05-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H29NO2/c1-16(2)15(17-13-9-5-3-6-10-13)18-14-11-7-4-8-12-14/h13-15H,3-12H2,1-2H3/p+1
