2016-56-0 Usage
General Description
Dodecylamine acetate is a chemical compound that consists of a dodecylamine molecule linked to an acetate group. It is commonly used as an emulsifier and dispersant in various industrial and commercial applications, including in the production of pharmaceuticals, personal care products, and agricultural formulations. Dodecylamine acetate helps to stabilize emulsions and suspensions by reducing surface tension and promoting the uniform distribution of particles or droplets in a liquid medium. It also has surfactant properties, allowing it to lower the interfacial tension between two immiscible phases, such as oil and water, and aiding in the formation of stable emulsions. Additionally, it can act as a corrosion inhibitor and antistatic agent in certain formulations. Overall, dodecylamine acetate plays a crucial role in enhancing the performance and stability of various products and formulations across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2016-56-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,1 and 6 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2016-56:
(6*2)+(5*0)+(4*1)+(3*6)+(2*5)+(1*6)=50
50 % 10 = 0
So 2016-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H28O2.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15;/h3-13H2,1-2H3;1H3/p+1
