20187-46-6 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 4-amino-2-hydroxypyrimidine-5-carboxylate is used as a reagent for the synthesis of cytidine-5-carboxylic acid derivatives, which are potential anticancer agents. Its role in the synthesis process is crucial, as it provides a starting material for the development of new drugs that can target and treat various types of cancer.
In the synthesis of cytidine-5-carboxylic acid, Ethyl 4-amino-2-hydroxypyrimidine-5-carboxylate serves as a key intermediate, allowing chemists to modify its structure and create a variety of related compounds with potential therapeutic properties. These synthesized compounds can then be further studied and tested for their efficacy in treating cancer, ultimately leading to the development of new and more effective treatments for patients.
Overall, Ethyl 4-amino-2-hydroxypyrimidine-5-carboxylate plays a significant role in the pharmaceutical industry, particularly in the research and development of novel anticancer agents. Its unique chemical properties and potential applications make it a valuable compound for further exploration and utilization in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 20187-46-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,1,8 and 7 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20187-46:
(7*2)+(6*0)+(5*1)+(4*8)+(3*7)+(2*4)+(1*6)=86
86 % 10 = 6
So 20187-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O3/c1-2-13-6(11)4-3-9-7(12)10-5(4)8/h3H,2H2,1H3,(H3,8,9,10,12)
