20263-93-8 Usage
Uses
Used in Pharmaceutical Industry:
(PHENYL-O-TOLYL-METHOXY)-ACETIC ACID is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, potentially targeting a range of medical conditions.
Used in Chemical Synthesis:
In the chemical industry, (PHENYL-O-TOLYL-METHOXY)-ACETIC ACID is used as a building block for the creation of other organic compounds. Its phenyl, tolyl, and methoxy groups provide versatility in chemical reactions, making it a valuable asset in the synthesis of a wide array of products.
Used in Research and Development:
(PHENYL-O-TOLYL-METHOXY)-ACETIC ACID is also utilized in research and development settings. Its unique properties make it an interesting subject for scientific study, potentially leading to new discoveries and innovations in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 20263-93-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,2,6 and 3 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 20263-93:
(7*2)+(6*0)+(5*2)+(4*6)+(3*3)+(2*9)+(1*3)=78
78 % 10 = 8
So 20263-93-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H16O3/c1-12-7-5-6-10-14(12)16(19-11-15(17)18)13-8-3-2-4-9-13/h2-10,16H,11H2,1H3,(H,17,18)