205518-89-4 Usage
General Description
2-Ethylpyrimidine-5-carbaldehyde is a chemical compound with the molecular formula C8H8N2O. It is a yellow liquid with a pungent odor, and is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 2-Ethylpyrimidine-5-carbaldehyde is known for its ability to act as a versatile building block in organic chemistry, and it can be used as a starting material for the preparation of various heterocyclic compounds. Its structure contains a pyrimidine ring with a carbaldehyde group and an ethyl substituent, making it a valuable compound in the field of chemical synthesis. Additionally, it has potential applications in the development of new materials and in various research areas.
Check Digit Verification of cas no
The CAS Registry Mumber 205518-89-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,5,5,1 and 8 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 205518-89:
(8*2)+(7*0)+(6*5)+(5*5)+(4*1)+(3*8)+(2*8)+(1*9)=124
124 % 10 = 4
So 205518-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O/c1-2-7-8-3-6(5-10)4-9-7/h3-5H,2H2,1H3