2058-02-8 Usage
Uses
Used in Pharmaceutical Research:
1-amino-9,10-dihydro-4-nitro-9,10-dioxoanthracene-2-carboxylic acid is used as a building block in pharmaceutical research for the synthesis of complex molecules with potential therapeutic properties. Its unique chemical structure allows for the development of new drugs with specific target affinities and bioactivities.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-amino-9,10-dihydro-4-nitro-9,10-dioxoanthracene-2-carboxylic acid is used as an intermediate in the synthesis of anticancer and antimicrobial agents. Its presence of both acidic and nitro functionalities makes it a versatile compound for the design of novel therapeutic agents.
Used in Organic Synthesis:
1-amino-9,10-dihydro-4-nitro-9,10-dioxoanthracene-2-carboxylic acid is used as a key intermediate in organic synthesis for the preparation of a variety of chemical compounds. Its reactivity and functional groups enable the formation of diverse molecular structures with potential applications in various industries.
Used in Dye and Pigment Manufacturing:
As a derivative of anthracene, 1-amino-9,10-dihydro-4-nitro-9,10-dioxoanthracene-2-carboxylic acid can be used in the manufacturing of dyes and pigments. Its chemical properties may contribute to the development of new colorants with improved characteristics, such as enhanced stability and color intensity.
Check Digit Verification of cas no
The CAS Registry Mumber 2058-02-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,5 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2058-02:
(6*2)+(5*0)+(4*5)+(3*8)+(2*0)+(1*2)=58
58 % 10 = 8
So 2058-02-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H8N2O6/c16-12-8(15(20)21)5-9(17(22)23)10-11(12)14(19)7-4-2-1-3-6(7)13(10)18/h1-5H,16H2,(H,20,21)
