20752-56-1 Usage
General Description
Magnesium tartrate is a chemical compound that consists of magnesium and tartrate, a salt or ester of tartaric acid. It is commonly used as a dietary supplement to provide the body with magnesium, an essential mineral that plays a crucial role in various biological processes, including muscle and nerve function, blood pressure regulation, and protein synthesis. Magnesium tartrate is often preferred over other forms of magnesium supplements due to its high bioavailability, which means that it is easily absorbed by the body. It is also used in food and beverage products as a food additive and acidity regulator. Additionally, magnesium tartrate has been studied for its potential therapeutic benefits in managing conditions like hypertension, cardiovascular disease, and migraine headaches.
Check Digit Verification of cas no
The CAS Registry Mumber 20752-56-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,7,5 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20752-56:
(7*2)+(6*0)+(5*7)+(4*5)+(3*2)+(2*5)+(1*6)=91
91 % 10 = 1
So 20752-56-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H6O6.Mg/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2
