212471-40-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Iodopyrazine-2-carboxylic acid is utilized as a synthetic intermediate for the creation of heterocyclic compounds and pharmaceutical drugs. Its iodine atom and carboxylic acid group contribute to its reactivity and structural diversity, which are essential for the development of new drug candidates with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 3-Iodopyrazine-2-carboxylic acid serves as a valuable building block. Its unique structure allows for a variety of chemical reactions, facilitating the synthesis of complex organic molecules with potential applications in medicine and pharmaceuticals.
Used in Drug Development:
3-Iodopyrazine-2-carboxylic acid is employed in the development of new drugs. Its presence in the molecular structure can influence the pharmacokinetics and pharmacodynamics of the resulting compounds, potentially leading to improved efficacy, selectivity, and safety profiles in medicinal applications.
Check Digit Verification of cas no
The CAS Registry Mumber 212471-40-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,2,4,7 and 1 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 212471-40:
(8*2)+(7*1)+(6*2)+(5*4)+(4*7)+(3*1)+(2*4)+(1*0)=94
94 % 10 = 4
So 212471-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H3IN2O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H,9,10)
212471-40-4Relevant academic research and scientific papers
First metallation of iodo diazines. Iodo and nitrogen directed metallations. Diazines XXII
Ple, Nelly,Turck, Alain,Heynderickx, Arnault,Queguiner, Guy
, p. 9701 - 9710 (2007/10/03)
Lithiation of iodopyrazine and 4-iodo-2-methylthiopyrimidine followed by reaction with various electrophiles was successfully achieved and was used to synthesize new pyrazine and pyrimidine derivatives. Iodo and nitrogen directed metallations were observed.
