214074-22-3 Usage
General Description
CYCLOPROPYL-(3-IODO-PYRIDIN-2-YL)-AMINE is a chemical compound that consists of a cyclopropyl group, a 3-iodo-pyridin-2-yl group, and an amine group. It is used in the field of organic chemistry and pharmaceuticals as a building block for the synthesis of various biologically active compounds. The cyclopropyl group confers unique reactivity and steric properties to the molecule, while the 3-iodo-pyridin-2-yl group provides a site for potential cross-coupling and functionalization reactions. The amine group allows for the compound to act as a nucleophile or a ligand in various chemical reactions, making it a versatile and valuable chemical building block. Additionally, compounds containing the 3-iodo-pyridin-2-yl group have been investigated for their potential pharmacological activities in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 214074-22-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,4,0,7 and 4 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 214074-22:
(8*2)+(7*1)+(6*4)+(5*0)+(4*7)+(3*4)+(2*2)+(1*2)=93
93 % 10 = 3
So 214074-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9IN2/c9-7-2-1-5-10-8(7)11-6-3-4-6/h1-2,5-6H,3-4H2,(H,10,11)
214074-22-3Relevant articles and documents
A dipyrido [2,3-b:3',2'-f]azepine analog of the HIV-1 reverse transcriptase inhibitor nevirapine
Dyatkin, Alexey B.,Brickwood, Janice R.,Proudfoot, John R.
, p. 2169 - 2272 (2007/10/03)
The syntheses of 11-ethyl and 11-cyclopropyldipyrido[2,3-b:3',2'- f]azepines, analogs of the HIV-1 reverse transcriptase inhibitor nevirapine 1, are described. These compounds exhibit potency equivalent to nevirapine in the inhibition of wild-type and some mutant RT enzymes.
