21962-47-0 Usage
Uses
Used in Pharmaceutical Industry:
2-CYANO-4-METHOXYBENZALDEHYDE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its chemical structure allows for the creation of a wide range of drug molecules, making it an essential component in the development of new medications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-CYANO-4-METHOXYBENZALDEHYDE is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its role in the production of these compounds contributes to the development of more effective and targeted agricultural products.
Used in Food Industry:
2-CYANO-4-METHOXYBENZALDEHYDE is used as a flavoring agent in the food industry, particularly for the production of flavored beverages and confectionery products. Its strong, sweet almond-like odor adds a unique and appealing taste to these food items, enhancing the overall consumer experience.
Used in Environmental Management:
2-CYANO-4-METHOXYBENZALDEHYDE has been identified as a potential intermediate in the formation of toxic by-products in the environment. As a result, it is used in research and development efforts aimed at understanding and mitigating the environmental impact of its release, ensuring responsible handling and disposal practices.
Check Digit Verification of cas no
The CAS Registry Mumber 21962-47-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,9,6 and 2 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 21962-47:
(7*2)+(6*1)+(5*9)+(4*6)+(3*2)+(2*4)+(1*7)=110
110 % 10 = 0
So 21962-47-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO2/c1-12-9-3-2-7(6-11)8(4-9)5-10/h2-4,6H,1H3