2199-52-2 Usage
General Description
Ethyl 2,5-dimethylpyrrole-3-carboxylate is a chemical compound with the molecular formula C10H13NO2. It is a pyrrole derivative with a carboxylate functional group and two methyl substituents at the 2 and 5 positions of the pyrrole ring. Ethyl2,5-dimethylpyrrole-3-carboxylate has potential applications in the field of organic synthesis and pharmaceuticals due to its unique structure and reactivity. It can be used as a building block for the synthesis of various heterocyclic compounds and can also serve as a precursor for the preparation of bioactive molecules. Additionally, its aromatic nature and electron-rich nature make it a valuable intermediate in organic chemistry reactions. Overall, ethyl 2,5-dimethylpyrrole-3-carboxylate is a versatile chemical compound with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 2199-52-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,9 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2199-52:
(6*2)+(5*1)+(4*9)+(3*9)+(2*5)+(1*2)=92
92 % 10 = 2
So 2199-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO2/c1-4-12-9(11)8-5-6(2)10-7(8)3/h5,10H,4H2,1-3H3
