2199-52-2 Usage
Uses
Used in Organic Synthesis:
Ethyl 2,5-dimethylpyrrole-3-carboxylate is used as a building block for the synthesis of various heterocyclic compounds. Its unique structure and reactivity allow for the creation of a wide range of organic molecules, contributing to the development of new chemical entities.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Ethyl 2,5-dimethylpyrrole-3-carboxylate serves as a precursor for the preparation of bioactive molecules. Its potential applications include the development of new drugs and therapeutic agents, leveraging its electron-rich nature and reactivity to enhance the pharmacological properties of the resulting compounds.
Used as an Intermediate in Organic Chemistry Reactions:
Due to its aromatic nature and electron-rich properties, Ethyl 2,5-dimethylpyrrole-3-carboxylate is a valuable intermediate in various organic chemistry reactions. It can be utilized in the synthesis of complex organic molecules, facilitating the development of innovative chemical processes and products across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2199-52-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,9 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2199-52:
(6*2)+(5*1)+(4*9)+(3*9)+(2*5)+(1*2)=92
92 % 10 = 2
So 2199-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO2/c1-4-12-9(11)8-5-6(2)10-7(8)3/h5,10H,4H2,1-3H3
