221037-98-5 Usage
Uses
Used in Pharmaceutical Industry:
3-Iodophenylboronic acid is used as a reactant for the synthesis of inhibitors of homoserine transacetylase, an enzyme involved in the biosynthesis of amino acids. These inhibitors can be employed as potential therapeutic agents for the treatment of certain diseases.
Used in Chemical Synthesis:
3-Iodophenylboronic acid is used as a coupling partner in aerobic oxidative coupling with arenes, which is a method for forming carbon-carbon bonds. This reaction is useful for the synthesis of various organic compounds and materials.
Used in Organic Synthesis:
3-Iodophenylboronic acid is used as a reactant in the coupling with acetals, a reaction that can lead to the formation of new organic compounds with potential applications in various fields.
Used in Boron-Heck Arylation:
3-Iodophenylboronic acid is used as a reactant in boron-Heck arylation with alkenes, a reaction that allows for the formation of new carbon-carbon bonds and the synthesis of various organic compounds.
Used in N-Arylation:
3-Iodophenylboronic acid is used as a reactant in N-arylation reactions, which involve the attachment of an aryl group to a nitrogen atom in a molecule. This reaction can be used to synthesize a variety of organic compounds with potential applications in different industries.
Used in Heck Reactions:
3-Iodophenylboronic acid is used as a reactant in Heck reactions with electrophilic alkenes, a type of reaction that can lead to the formation of new carbon-carbon bonds and the synthesis of various organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 221037-98-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,1,0,3 and 7 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 221037-98:
(8*2)+(7*2)+(6*1)+(5*0)+(4*3)+(3*7)+(2*9)+(1*8)=95
95 % 10 = 5
So 221037-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BIO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H
221037-98-5Relevant academic research and scientific papers
NEW COMPOUND
-
Paragraph 0316; 0326, (2019/11/26)
PROBLEM TO BE SOLVED: To provide a new compound that does not have structural similarity to ceramide and has excellent CERT inhibitory activity. SOLUTION: The present invention provides a new compound of structural formula (I). A bond group -X- is cis-cyclopropyl-, R1, R2, R3, R4, and R5 independently represent a hydrogen atom, a halogen atom, a linear or branched C1-C8 alkyl group that may have a halogen atom, or OR6. SELECTED DRAWING: Figure 1 COPYRIGHT: (C)2020,JPOandINPIT
