22237-20-3 Usage
Type of compound
Boron-containing heterocyclic compound
Use as a quencher
Efficiently absorbs emitted light from nearby fluorophores, making it useful in fluorescence resonance energy transfer (FRET) assays
Applications
Detection and measurement of biological and chemical processes, such as DNA hybridization, protein-protein interactions, and enzyme activities
Use in synthesis
Unique structure and properties make it useful in the synthesis of various organic compounds and materials
Check Digit Verification of cas no
The CAS Registry Mumber 22237-20-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,3 and 7 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 22237-20:
(7*2)+(6*2)+(5*2)+(4*3)+(3*7)+(2*2)+(1*0)=73
73 % 10 = 3
So 22237-20-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BN2O4/c14-13(15)10-3-1-2-9(8-10)11-16-6-4-12-5-7-17-11/h1-3,8,12H,4-7H2