223433-45-2 Usage
General Description
2-(Morpholin-4-ylmethyl)benzeneboronic acid is a chemical compound with the molecular formula C10H13BNO3. It is a boronic acid derivative that contains a morpholine ring, which is a heterocyclic amine. 2-(Morpholin-4-ylmethyl)benzeneboronic acid is used in organic chemistry as a building block in the synthesis of various pharmaceuticals, agrochemicals, and materials. It can also be used as a ligand in transition metal-catalyzed cross-coupling reactions. Additionally, its boronic acid functionality allows it to form reversible covalent bonds with diols and other nucleophiles, making it useful in the development of sensors and probes for carbohydrate recognition and other biological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 223433-45-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,4,3 and 3 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 223433-45:
(8*2)+(7*2)+(6*3)+(5*4)+(4*3)+(3*3)+(2*4)+(1*5)=102
102 % 10 = 2
So 223433-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H16BNO3/c14-12(15)11-4-2-1-3-10(11)9-13-5-7-16-8-6-13/h1-4,14-15H,5-9H2
