22353-35-1 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-3-chloro-5-nitropyridine is used as an intermediate in the manufacturing of pharmaceuticals for its potential role in the synthesis of various drug molecules. Its presence in the development process can contribute to the creation of new medications with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 2-amino-3-chloro-5-nitropyridine serves as an intermediate in the production of agrochemicals, potentially aiding in the development of new pesticides or other agricultural chemicals that can enhance crop protection and yield.
Used in Organic Synthesis:
2-Amino-3-chloro-5-nitropyridine is utilized as a building block in organic synthesis, where it can be incorporated into more complex organic compounds. Its unique functional groups facilitate reactions that lead to the formation of a wide range of chemical products.
Used in Material Science:
2-AMINO-3-CHLORO-5-NITROPYRIDINE has been studied for its potential use in material science, where it could contribute to the development of new materials with specific properties. Its structural features make it a candidate for use in the creation of advanced materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 22353-35-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,3,5 and 3 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 22353-35:
(7*2)+(6*2)+(5*3)+(4*5)+(3*3)+(2*3)+(1*5)=81
81 % 10 = 1
So 22353-35-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H4ClN3O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H,(H2,7,8)
22353-35-1Relevant academic research and scientific papers
Effect of the 3-halo substitution of the 2′-deoxy aminopyridinyl-pseudocytidine derivatives on the selectivity and stability of antiparallel triplex DNA with a CG inversion site
Wang, Lei,Taniguchi, Yosuke,Okamura, Hidenori,Sasaki, Shigeki
, p. 3853 - 3860 (2017/06/13)
Triplex formation against a target duplex DNA has the potential to become a tool for the genome research. However, there is an intrinsic restriction on the duplex DNA sequences capable of forming the triplex DNA. Recently, we demonstrated the selective fo
