2255-94-9 Usage
Uses
Used in Organic Synthesis:
5-Chloro-6-methyl-2,1,3-benzoselenodiazole is used as a synthetic building block for the creation of more complex organic molecules. Its unique structure, which includes a selenium atom and a chlorine substituent, allows it to participate in a range of chemical reactions, facilitating the synthesis of various compounds with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-Chloro-6-methyl-2,1,3-benzoselenodiazole is used as a key intermediate in the development of new drugs. Its chemical properties make it a versatile component in the synthesis of novel therapeutic agents, potentially leading to the discovery of new medications with improved efficacy and reduced side effects.
Used in Chemical Research:
5-Chloro-6-methyl-2,1,3-benzoselenodiazole is also utilized in academic and industrial research settings. Its unique structural features and reactivity make it an interesting subject for studying various chemical phenomena, such as reaction mechanisms, stereochemistry, and the influence of heteroatoms on molecular properties.
Used in Material Science:
In the field of material science, 5-Chloro-6-methyl-2,1,3-benzoselenodiazole may be employed in the development of new materials with specific properties. Its incorporation into polymers or other materials could potentially lead to the creation of materials with enhanced electrical, optical, or mechanical characteristics, depending on the desired application.
Used in Environmental Applications:
5-Chloro-6-methyl-2,1,3-benzoselenodiazole may also find use in environmental applications, such as the development of new methods for pollution control or the creation of more sustainable chemical processes. Its unique properties could contribute to the design of more efficient and eco-friendly technologies, addressing various environmental challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 2255-94-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,5 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2255-94:
(6*2)+(5*2)+(4*5)+(3*5)+(2*9)+(1*4)=79
79 % 10 = 9
So 2255-94-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2Se/c1-4-2-6-7(3-5(4)8)10-11-9-6/h2-3H,1H3
2255-94-9Relevant academic research and scientific papers
Synthesis of Mutagenic Methyl- and Phenyl-substituted 2-Amino-3H-imidazoquinoxalines via 2,1,3-Benzoselenadiazoles
Grivas, Spiros,Tian, Wei,Ronne, Erik,Lindstroem, Stefan,Olsson, Kjell
, p. 521 - 528 (2007/10/02)
2-Amino-3-methyl-3H-imidazoquinoxaline, all its derivatives with 1-4 methyl groups in positions 4, 5, 7 and 8, and 2-amino-3,5-dimethyl-7,8-diphenyl-3H-imidazoquinoxaline have been synthesized from the corresponding 6-methylamino-5-nitroquinoxalines through reduction and cyclization with cyanogen bromide.The quinoxalines were obtained from the appropriate α-dicarbonyl compounds and 4-methylamino-3-nitro-1,2-benzenediamines.The latter were prepared from 4-halo-1,2-benzenediamines via 2,1,3-benzoselenadiazoles.The 7- and 8-phenyl derivatives of 2-amino-3,5-dimethyl-3H-imidazoquinoxaline have been synthesized in a slightly different way.
