23068-87-3 Usage
Uses
Used in Pharmaceutical Industry:
4,4-Dimethoxybutan-1-ol is used as a reactant for the preparation of tetrahydropyranols and hydropyranooxepans, which are important building blocks in the synthesis of complex organic molecules, including those with pharmaceutical relevance. These compounds can be further modified to create a wide range of therapeutic agents, such as drugs targeting specific diseases or conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4,4-Dimethoxybutan-1-ol is used as a versatile intermediate for the preparation of various organic compounds. Its unique structure allows for a range of reactions, including substitution, addition, and condensation, making it a valuable starting material for the synthesis of complex molecules with potential applications in various industries.
Used in Flavor and Fragrance Industry:
4,4-Dimethoxybutan-1-ol, due to its specific chemical structure, can also be used in the flavor and fragrance industry as a starting material for the synthesis of various aroma compounds. These compounds can be used to create unique scents and flavors for a wide range of products, from perfumes and colognes to food and beverages.
Check Digit Verification of cas no
The CAS Registry Mumber 23068-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,0,6 and 8 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 23068-87:
(7*2)+(6*3)+(5*0)+(4*6)+(3*8)+(2*8)+(1*7)=103
103 % 10 = 3
So 23068-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H14O3/c1-8-6(9-2)4-3-5-7/h6-7H,3-5H2,1-2H3
