23180-59-8 Usage
Uses
Used in Organic Synthesis:
(2E,8Z)-2,8-Decadiene-4,6-diynoic acid methyl ester is used as a building block for the preparation of various compounds. Its presence of diene and diynoic acid groups makes it suitable for applications in organic and polymer chemistry, allowing for the creation of a wide range of chemical products.
Used in Chemical Research:
In the field of chemical research, (2E,8Z)-2,8-Decadiene-4,6-diynoic acid methyl ester serves as an important compound for studying the properties and reactions of diene and diynoic acid functional groups. Its versatility aids in advancing the understanding of chemical reactions and mechanisms.
Used in Polymer Chemistry:
(2E,8Z)-2,8-Decadiene-4,6-diynoic acid methyl ester is also utilized in polymer chemistry due to its ability to contribute to the formation of polymers with specific properties. (2E,8Z)-2,8-Decadiene-4,6-diynoic acid methyl ester's structure allows it to be integrated into polymer chains, potentially influencing their characteristics such as strength, flexibility, and reactivity.
Used to Enhance Solubility and Reactivity:
The methyl ester group in (2E,8Z)-2,8-Decadiene-4,6-diynoic acid methyl ester enhances its solubility and reactivity in organic solvents. This feature is particularly useful in chemical processes where solubility can affect the efficiency and outcome of reactions, making the compound a valuable asset in various chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 23180-59-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,1,8 and 0 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 23180-59:
(7*2)+(6*3)+(5*1)+(4*8)+(3*0)+(2*5)+(1*9)=88
88 % 10 = 8
So 23180-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-4,9-10H,1-2H3/b4-3-,10-9+