23299-18-5 Usage
Uses
Used in Pharmaceutical Industry:
3-Chlorophenylmethylsulfonyl chloride is used as a synthetic intermediate for the development of various pharmaceuticals. Its reactivity allows for the creation of a wide range of organic compounds that contribute to the efficacy and function of different medications.
Used in Agrochemical Industry:
In the agrochemical sector, 3-chlorophenylmethanesulfonyl chloride is utilized as a key component in the synthesis of compounds that serve various purposes, such as pest control and crop protection. Its ability to undergo multiple chemical reactions facilitates the production of effective agrochemicals.
Used in Organic Synthesis:
3-Chlorophenylmethylsulfonyl chloride is employed as a reagent in organic synthesis for creating diverse organic compounds. Its high reactivity with different chemical groups makes it a valuable tool in the synthesis of specialty chemicals and complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 23299-18-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,2,9 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 23299-18:
(7*2)+(6*3)+(5*2)+(4*9)+(3*9)+(2*1)+(1*8)=115
115 % 10 = 5
So 23299-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H16ClNO/c1-8(2)13-7-11(14)9-4-3-5-10(12)6-9/h3-6,8,11,13-14H,7H2,1-2H3
