23424-28-4 Usage
General Description
Acetic-1-13C Acid, Sodium Salt is a specialized chemical compound often used as a reagent in various laboratory and research settings. The '13C' denotes a particular isotope of carbon, making this a form of isotopically labelled compound. The presence of sodium indicates that this compound is a salt, which typically means it can dissolve in water to produce ions. As a derivative of acetic acid, it possesses similar properties such as a sour taste and strong, pungent smell. It's commonly used to study metabolic processes and mechanisms involving acetic acid, due to its unique tracer properties provided by the carbon-13 isotope.
Check Digit Verification of cas no
The CAS Registry Mumber 23424-28-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,4,2 and 4 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 23424-28:
(7*2)+(6*3)+(5*4)+(4*2)+(3*4)+(2*2)+(1*8)=84
84 % 10 = 4
So 23424-28-4 is a valid CAS Registry Number.
InChI:InChI=1/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1/i2+1;
23424-28-4Relevant articles and documents
PROCESS FOR THE PREPARATION OF HYPERPOLARIZED CARBOXYLATE COMPOUNDS
-
Page/Page column 33-34, (2015/05/19)
The present invention relates to a process for the preparation of aqueous solutions of [1-13C]-hyperpolarized carboxylate containing molecules of diagnostic interest that comprises parahydrogenating with molecular parahydrogen unsaturated alkenyl or alkynyl esters of the concerned 13C- carboxylate molecules.
