23576-80-9 Usage
General Description
(2-imino-thiazol-3-yl)-acetic acid is a chemical compound with the molecular formula C6H6N2O2S. It is a thiazole derivative and contains an imino-thiazole group. (2-IMINO-THIAZOL-3-YL)-ACETIC ACID has been studied for its potential biological activities, including anti-inflammatory and analgesic properties. It is also known for its potential to inhibit the production of prostaglandins, which are involved in inflammation and pain. Additionally, (2-imino-thiazol-3-yl)-acetic acid has been investigated for its potential role in treating conditions such as rheumatoid arthritis and other inflammatory diseases. Overall, this compound has the potential to be utilized in pharmaceutical research for the development of new anti-inflammatory drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 23576-80-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,5,7 and 6 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 23576-80:
(7*2)+(6*3)+(5*5)+(4*7)+(3*6)+(2*8)+(1*0)=119
119 % 10 = 9
So 23576-80-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O2S/c6-5-7(1-2-10-5)3-4(8)9/h1-2,6H,3H2,(H,8,9)
