75001-30-8 Usage
Uses
Used in Organic Synthesis:
Imidazo[2,1-b]thiazole, 6-bromoserves as a building block or intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials. Its unique structure allows for the development of novel compounds with potential applications in different industries.
Used in Pharmaceutical Industry:
Imidazo[2,1-b]thiazole, 6-bromomay exhibit biological activity, making it a valuable research tool in the study of imidazole-containing compounds. Its potential use in the development of new drugs and therapeutic agents is an area of interest for pharmaceutical researchers.
Used in Agrochemical Industry:
IMidazo[2,1-b]thiazole, 6-broMomay also find applications in the agrochemical industry, where it could be utilized in the development of new pesticides, herbicides, or other agricultural chemicals.
Used in Materials Science:
Imidazo[2,1-b]thiazole, 6-bromocould be employed in the development of new materials with specific properties, such as conductivity, stability, or reactivity, depending on the needs of various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 75001-30-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,0,0 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 75001-30:
(7*7)+(6*5)+(5*0)+(4*0)+(3*1)+(2*3)+(1*0)=88
88 % 10 = 8
So 75001-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrN2S/c6-4-3-8-1-2-9-5(8)7-4/h1-3H
