2364-76-3 Usage
Uses
Used in Pharmaceutical Research:
3-CHLORO-N-(4-METHOXY-BENZYL)-PROPIONAMIDE is used as a research compound for exploring its potential antiviral, antibacterial, or antifungal properties. Its unique structure allows it to interact with biological systems through various mechanisms, offering a broad scope for medicinal development.
Used in Organic Synthesis:
In the field of organic chemistry, 3-CHLORO-N-(4-METHOXY-BENZYL)-PROPIONAMIDE serves as a building block for the synthesis of more complex organic compounds. Its amide functional group provides versatility in chemical reactions, facilitating the creation of a wide range of pharmaceutically relevant molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 2364-76-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,6 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2364-76:
(6*2)+(5*3)+(4*6)+(3*4)+(2*7)+(1*6)=83
83 % 10 = 3
So 2364-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H14ClNO2/c1-15-10-4-2-9(3-5-10)8-13-11(14)6-7-12/h2-5H,6-8H2,1H3,(H,13,14)