24005-61-6 Usage
Uses
Used in Food and Beverage Industry:
6-Methoxy-pyrazinecarboxylic acid is used as a flavoring agent for its characteristic nutty and roasted aroma, enhancing the taste and aroma of various food and beverage products.
Used in Fragrance Industry:
In the fragrance industry, 6-Methoxy-pyrazinecarboxylic acid is used in perfumes and colognes to provide a unique and pleasant scent, contributing to the overall appeal of these products.
Used in Pharmaceutical Research:
6-Methoxy-pyrazinecarboxylic acid has been studied for its potential antioxidant and anti-inflammatory properties, making it a topic of interest in pharmaceutical research. Its potential benefits in this field could lead to the development of new drugs and treatments for various health conditions.
Overall, 6-Methoxy-pyrazinecarboxylic acid is a versatile compound with diverse applications in the food and beverage, fragrance, and pharmaceutical industries, offering unique properties and potential benefits in each of these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 24005-61-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,0,0 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 24005-61:
(7*2)+(6*4)+(5*0)+(4*0)+(3*5)+(2*6)+(1*1)=66
66 % 10 = 6
So 24005-61-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c1-11-5-3-7-2-4(8-5)6(9)10/h2-3H,1H3,(H,9,10)
