24030-00-0 Usage
Uses
Used in Pharmaceutical Industry:
4-methylthiophen-3-amine hydrochloride is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a potential candidate in drug development, contributing to the creation of new medications.
Used in Chemical Research:
4-methylthiophen-3-amine hydrochloride is used as a research compound in the field of organic chemistry. It aids scientists in understanding the properties and reactions of compounds containing thiophene rings and amine groups, which can lead to advancements in chemical research.
Used in Synthesis of Complex Organic Molecules:
4-methylthiophen-3-amine hydrochloride is used as a building block in the synthesis of complex organic molecules. Its presence in these molecules can impart specific properties, making it a valuable component in the creation of advanced materials and compounds.
It is essential that this chemical compound should be handled by trained individuals in a controlled environment due to potential hazards associated with its usage.
Check Digit Verification of cas no
The CAS Registry Mumber 24030-00-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,0,3 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 24030-00:
(7*2)+(6*4)+(5*0)+(4*3)+(3*0)+(2*0)+(1*0)=50
50 % 10 = 0
So 24030-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H7NS.ClH/c1-4-2-7-3-5(4)6;/h2-3H,6H2,1H3;1H
24030-00-0Relevant academic research and scientific papers
PROCESS FOR PREPARING 4-METHYL-3-THIENYLAMINE HYDROCHLORIDE
-
Page/Page column 4-5, (2011/02/24)
This invention is related to a process for preparing 3-amino-4-methylthiophene hydrochloride.
