24447-68-5 Usage
Description
3-Aminopyrazole-4-carboxylic acid is an organic compound with the chemical formula C5H5N3O2. It is a derivative of pyrazole and has a carboxylic acid functional group attached to the 4-position of the pyrazole ring. 3-Aminopyrazole-4-carboxylic acid is known for its versatile applications in medicinal chemistry and other fields.
Uses
Used in Medicinal Chemistry:
3-Aminopyrazole-4-carboxylic acid is used as a building block for the synthesis of pharmaceuticals and bioactive molecules. Its unique structure allows for the creation of a variety of compounds with potential therapeutic effects.
Used in Coordination Chemistry:
In coordination chemistry, 3-Aminopyrazole-4-carboxylic acid serves as a ligand, which can bind to metal ions to form coordination compounds. This application is valuable for the development of new materials with specific properties.
Used in Synthesis of Heterocyclic Compounds:
3-Aminopyrazole-4-carboxylic acid is used as a precursor in the synthesis of heterocyclic compounds. These compounds are important in various chemical and pharmaceutical applications due to their diverse structures and properties.
Used in Corrosion Inhibition:
3-Aminopyrazole-4-carboxylic acid has potential utility as a corrosion inhibitor. Its ability to form a protective layer on metal surfaces makes it a candidate for use in industries where metal protection is crucial, such as in the automotive, aerospace, and construction sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 24447-68-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,4,4 and 7 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 24447-68:
(7*2)+(6*4)+(5*4)+(4*4)+(3*7)+(2*6)+(1*8)=115
115 % 10 = 5
So 24447-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O2/c5-3-2(4(8)9)1-6-7-3/h1H,(H,8,9)(H3,5,6,7)
