2445-60-5 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
1,3-DIMETHYL-5-[(1-METHYL-2-PYRROLIDINYLIDENE)ETHYLIDENE]-2-THIOXO-4-IMIDAZOLIDINONE is utilized as a subject of interest in pharmaceutical research and drug development due to its unique structure and properties. Its potential pharmacological activity, as observed in preclinical studies, positions it as a candidate for the development of new therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1,3-DIMETHYL-5-[(1-METHYL-2-PYRROLIDINYLIDENE)ETHYLIDENE]-2-THIOXO-4-IMIDAZOLIDINONE is employed for its potential to contribute to the discovery and design of novel drugs. Its complex molecular structure and the presence of various functional groups make it a valuable compound for exploring new avenues in drug development and therapeutic interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 2445-60-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,4 and 5 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2445-60:
(6*2)+(5*4)+(4*4)+(3*5)+(2*6)+(1*0)=75
75 % 10 = 5
So 2445-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N3OS/c1-13-8-4-5-9(13)6-7-10-11(16)15(3)12(17)14(10)2/h6-7H,4-5,8H2,1-3H3/b9-6+,10-7+
