2445-60-5 Usage
General Description
1,3-DIMETHYL-5-[(1-METHYL-2-PYRROLIDINYLIDENE)ETHYLIDENE]-2-THIOXO-4-IMIDAZOLIDINONE is a chemical compound with a complex molecular structure. It contains a thioxo and imidazolidinone group, and the presence of multiple methyl and pyrrolidinylidene groups in its structure. 1,3-DIMETHYL-5-[(1-METHYL-2-PYRROLIDINYLIDENE)ETHYLIDENE]-2-THIOXO-4-IMIDAZOLIDINONE is commonly used in pharmaceutical research and drug development, as it has demonstrated potential pharmacological activity in various preclinical studies. Its unique structure and properties make it a subject of interest for researchers in the field of medicinal chemistry and drug design, as it may have therapeutic applications in the future.
Check Digit Verification of cas no
The CAS Registry Mumber 2445-60-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,4 and 5 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2445-60:
(6*2)+(5*4)+(4*4)+(3*5)+(2*6)+(1*0)=75
75 % 10 = 5
So 2445-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N3OS/c1-13-8-4-5-9(13)6-7-10-11(16)15(3)12(17)14(10)2/h6-7H,4-5,8H2,1-3H3/b9-6+,10-7+