24507-28-6 Usage
Uses
Used in Organic Synthesis:
Methyl 3-bromo-4-ethoxybenzoate is utilized as a key intermediate in organic synthesis for its ability to participate in a variety of chemical reactions, facilitating the creation of complex organic molecules.
Used in Pharmaceutical Research:
In pharmaceutical research, Methyl 3-bromo-4-ethoxybenzoate is employed as a building block for the development of new drugs. Its unique structure allows it to be a versatile component in the synthesis of potential therapeutic agents.
Used in Chemical Product Production:
Methyl 3-bromo-4-ethoxybenzoate is used as a crucial component in the production of various chemical products, contributing to the formulation and properties of these products due to its reactivity.
Used in Agrochemical Development:
In the agrochemical industry, Methyl 3-bromo-4-ethoxybenzoate is used as a precursor in the synthesis of new agrochemicals, potentially leading to the development of more effective and targeted pesticides or herbicides.
Used in Fine Chemicals:
Methyl 3-bromo-4-ethoxybenzoate is also utilized in the synthesis of fine chemicals, where its specific reactivity and functional groups are harnessed to create high-value specialty chemicals for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 24507-28-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,5,0 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 24507-28:
(7*2)+(6*4)+(5*5)+(4*0)+(3*7)+(2*2)+(1*8)=96
96 % 10 = 6
So 24507-28-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BrO3/c1-3-14-9-5-4-7(6-8(9)11)10(12)13-2/h4-6H,3H2,1-2H3
