24779-49-5 Usage
Uses
Used in Pharmaceutical Industry:
Trans-1,2,5-Trimethylpiperazine is used as a building block for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its presence of nitrogen atoms allows it to act as a chelating agent, which can improve the solubility and bioavailability of certain drugs.
Used in Agrochemical Industry:
In the agrochemical industry, trans-1,2,5-Trimethylpiperazine is utilized as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its ability to form stable complexes with metal ions can enhance the effectiveness and selectivity of these agrochemicals.
Used in Specialty Chemicals Industry:
Trans-1,2,5-Trimethylpiperazine is employed as a key intermediate in the production of specialty chemicals, including corrosion inhibitors, surfactants, and dyes. Its unique chemical properties enable the development of innovative products with specific applications in various industries.
Used as a Chelating Agent:
Trans-1,2,5-Trimethylpiperazine is used as a chelating agent in various applications, such as water treatment and metal extraction processes. Its ability to form stable complexes with metal ions helps in the efficient removal of metal contaminants and improves the overall efficiency of these processes.
Used as a Base in Organic Reactions:
In organic synthesis, trans-1,2,5-Trimethylpiperazine serves as a base, facilitating various chemical reactions. Its basic nature allows it to act as a catalyst or a reagent in the synthesis of complex organic molecules, contributing to the development of new chemical compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 24779-49-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,7,7 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 24779-49:
(7*2)+(6*4)+(5*7)+(4*7)+(3*9)+(2*4)+(1*9)=145
145 % 10 = 5
So 24779-49-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N2/c1-6-5-9(3)7(2)4-8-6/h6-8H,4-5H2,1-3H3/t6-,7+/m0/s1
