253668-46-1 Usage
General Description
2-FLUORO-6-METHOXYBENZYL ALCOHOL is a chemical compound that belongs to the class of benzyl alcohols. It is composed of a benzene ring with a fluorine atom at the 2-position and a methoxy group at the 6-position. 2-FLUORO-6-METHOXYBENZYL ALCOHOL is commonly used in organic synthesis as a reagent or building block for the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure and functional groups make it a valuable intermediate in the synthesis of various organic compounds. Additionally, 2-FLUORO-6-METHOXYBENZYL ALCOHOL may also have potential applications in the development of new drugs or biologically active molecules due to its specific chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 253668-46-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,3,6,6 and 8 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 253668-46:
(8*2)+(7*5)+(6*3)+(5*6)+(4*6)+(3*8)+(2*4)+(1*6)=161
161 % 10 = 1
So 253668-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H9FO2/c1-11-8-4-2-3-7(9)6(8)5-10/h2-4,10H,5H2,1H3
253668-46-1Relevant articles and documents
MULTIPLE KINASE PATHWAY INHIBITORS
-
Page/Page column 299-300, (2014/04/17)
Kinase with inhibitory activity against kinases disposed in multiple signaling pathways and their therapeutic uses.
