2545-56-4 Usage
General Description
2-acetamido-5-oxo-5-phenyl-pentanoic acid is a chemical compound with the molecular formula C12H13NO4. It is a derivative of pentanoic acid, featuring an acetamido group at the 2 position and a phenyl group at the 5 position. 2-acetamido-5-oxo-5-phenyl-pentanoic acid is commonly used as an intermediate in the synthesis of pharmaceuticals and other organic compounds. It has potential applications in the field of medicinal chemistry due to its structural features, which may contribute to its pharmacological activity. Additionally, 2-acetamido-5-oxo-5-phenyl-pentanoic acid may have uses in the development of new materials and as a building block for the creation of novel chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 2545-56-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,5,4 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2545-56:
(6*2)+(5*5)+(4*4)+(3*5)+(2*5)+(1*6)=84
84 % 10 = 4
So 2545-56-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO4/c1-9(15)14-11(13(17)18)7-8-12(16)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,14,15)(H,17,18)
