25741-97-3 Usage
Uses
Used in Chemical Research:
Isoxazole, 3-bromo-5-methyl(6CI,7CI,8CI,9CI) is used as a reagent for its role in various chemical reactions, contributing to the advancement of scientific knowledge and the development of new compounds.
Used in Pharmaceutical Industry:
Isoxazole, 3-bromo-5-methyl(6CI,7CI,8CI,9CI) is used as a building block in the synthesis of pharmaceutical compounds, potentially leading to the creation of new drugs and therapeutic agents.
Used in Chemical Manufacturing:
Isoxazole, 3-bromo-5-methyl(6CI,7CI,8CI,9CI) is used as an intermediate in the manufacturing of other chemical substances, playing a crucial role in the production process of various industrial products.
Check Digit Verification of cas no
The CAS Registry Mumber 25741-97-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,7,4 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 25741-97:
(7*2)+(6*5)+(5*7)+(4*4)+(3*1)+(2*9)+(1*7)=123
123 % 10 = 3
So 25741-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BrNO/c1-3-2-4(5)6-7-3/h2H,1H3
