259180-65-9 Usage
Uses
Used in Pharmaceutical Industry:
1-Piperidineacetonitrile,4-oxo-(9CI) is utilized as a key intermediate in the development and production of various pharmaceuticals. Its unique structure allows for the creation of a broad spectrum of medicinal compounds, contributing to the advancement of treatments for numerous diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 1-Piperidineacetonitrile,4-oxo-(9CI) serves as a crucial component in the synthesis of pesticides and other crop protection agents. Its incorporation enhances the effectiveness of these products, promoting agricultural productivity and food security.
Used in Organic Synthesis:
1-Piperidineacetonitrile,4-oxo-(9CI) is employed as a reagent in organic synthesis, facilitating the preparation of a diverse array of organic compounds. Its presence in chemical reactions can lead to the formation of complex molecules with specific properties, broadening the scope of chemical research and innovation.
Used in Heterocyclic Compounds Synthesis:
As a starting material, 1-Piperidineacetonitrile,4-oxo-(9CI) is instrumental in the synthesis of heterocyclic compounds. These compounds are essential in various fields, including medicinal chemistry, materials science, and the development of new pharmaceutical agents.
Overall, 1-Piperidineacetonitrile,4-oxo-(9CI) is a multifaceted chemical intermediate with applications spanning across different industries, underpinning its significance in both academic research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 259180-65-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,9,1,8 and 0 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 259180-65:
(8*2)+(7*5)+(6*9)+(5*1)+(4*8)+(3*0)+(2*6)+(1*5)=159
159 % 10 = 9
So 259180-65-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c8-3-6-9-4-1-7(10)2-5-9/h1-2,4-6H2
259180-65-9Relevant academic research and scientific papers
Heterocyclization and Spirocyclization Processes Based on Domino Reactions of N-Tosylhydrazones and Boronic Acids Involving Intramolecular Allylborylations of Nitriles
Plaza, Manuel,Parisotto, Stefano,Valdés, Carlos
supporting information, p. 14836 - 14843 (2018/09/25)
Polycyclic molecules featuring all-carbon quaternary bridgehead centers were synthesized through domino cyclizations between N-tosylhydrazones and boronic acids. Variations of the general cascade have been applied for the preparation of 3-quinuclidinones and related alkaloid-like scaffolds through transannular heterocyclizations. Moreover, the employment of 3-cyanopropyl and 4-cyanobutylboronic acids and α,β-unsaturated N-tosylhydrazones led to spirocycles through unprecedented formal [n+1] cyclizations, including the stereoselective spirocyclization of the Hajos–Parrish ketone. The common feature of all the new reactions described is the creation of an all-carbon quaternary center by formation of two Csp3?C bonds on the hydrazonic carbon atom. DFT-based calculations suggested the occurrence of cascade processes, which involve a diazo compound carboborylation followed by a 1,3-borotropic rearrangement on an intermediate allylboronic acid and a novel bora-aza-ene cyclization.
1H-imidazopyridine derivatives
-
, (2008/06/13)
1H-Imidazopyridine derivatives represented by the following general formula or salts thereof: wherein R1represents hydrogen atom, hydroxyl group, an alkyl group, a cycloalkyl group, styryl group, or an aryl group; R2represents hydrog