25939-87-1 Usage
Uses
Used in Pharmaceutical Development:
Pyrazolo[1,5-a]pyrimidine-3-carbonitrile is used as a key intermediate in the synthesis of various drugs. Its unique structure and properties allow it to be incorporated into drug molecules, potentially leading to new therapeutic agents with novel mechanisms of action.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, Pyrazolo[1,5-a]pyrimidine-3-carbonitrile serves as a valuable compound for studying the structure-activity relationships of potential drug candidates. Its presence in drug molecules can influence their interactions with biological targets, such as enzymes or receptors, and contribute to their overall efficacy and safety.
Used in Drug Design and Optimization:
Pyrazolo[1,5-a]pyrimidine-3-carbonitrile is utilized as a building block in the design of new drugs. Its incorporation into drug candidates can enhance their pharmacokinetic properties, such as solubility, stability, and bioavailability, which are crucial for their therapeutic success.
Used in Anticancer Applications:
Pyrazolo[1,5-a]pyrimidine-3-carbonitrile may be used as an anticancer agent or in the development of anticancer drugs. Its potential to modulate oncological signaling pathways or inhibit the growth of cancer cells could make it a promising candidate for cancer therapy.
Used in Drug Delivery Systems:
Pyrazolo[1,5-a]pyrimidine-3-carbonitrile can be employed in the development of drug delivery systems to improve the delivery, bioavailability, and therapeutic outcomes of drugs. Its incorporation into nanoparticles or other carriers can enhance the drug's performance and effectiveness in treating various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 25939-87-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,9,3 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 25939-87:
(7*2)+(6*5)+(5*9)+(4*3)+(3*9)+(2*8)+(1*7)=151
151 % 10 = 1
So 25939-87-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N4/c8-4-6-5-10-11-3-1-2-9-7(6)11/h1-3,5H
25939-87-1Relevant academic research and scientific papers
PREPARATION AND CHARACTERIZATION OF PYRAZOLOPYRIMIDINES
Maquestiau, A.,Taghret, H.,Eynde, J.-J. vanden
, p. 131 - 136 (2007/10/02)
1-Phenyl-1,3-butadione readily reacts with 3(5)-amino-1H-pyrazoles to yield mixtures of pyrazolopyrimidines which are identified by 1H nmr.Selective preparation of 5-methyl-7-phenylpyrazolopyrimidines can be achieved when 3-amino-1-phenyl-2-
