26474-40-8 Usage
Uses
Used in Biotechnology and Molecular Biology:
cis-Parinaric acid methyl ester is used as a staining agent for differential coloration of nucleic acids. It is particularly utilized in the methyl green-pyronin method, which allows for the distinct visualization of DNA and RNA within cells. This application is crucial for research and diagnostic purposes in the fields of genetics, cell biology, and molecular diagnostics.
Used in Pharmaceutical Industry:
cis-Parinaric acid methyl ester is used as an intermediate in the synthesis of various pharmaceutical compounds. Its lipophilic nature makes it a valuable component in the development of drugs that require enhanced solubility and bioavailability.
Used in Chemical Research:
cis-Parinaric acid methyl ester serves as a valuable compound in chemical research, particularly in the study of lipids, fatty acids, and their derivatives. Its unique properties make it an essential tool for understanding the structure and function of various biological molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 26474-40-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,7 and 4 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 26474-40:
(7*2)+(6*6)+(5*4)+(4*7)+(3*4)+(2*4)+(1*0)=118
118 % 10 = 8
So 26474-40-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-11H,3,12-18H2,1-2H3/b5-4+,7-6+,9-8-,11-10-
