26829-77-6 Usage
Uses
Used in Chemical Synthesis:
3-Chloro-2,6-dimethylaniline is used as a chemical intermediate for the production of various organic compounds. Its reactivity allows for further functionalization and the creation of a wide range of products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-chloro-2,6-dimethylaniline is used as a starting material for the synthesis of various drugs and drug candidates. Its unique chemical structure makes it a valuable component in the development of new medications.
Used in Dye Manufacturing:
3-Chloro-2,6-dimethylaniline is also utilized in the manufacturing of dyes and pigments due to its ability to form colored compounds when reacted with other chemicals.
Used in Agricultural Chemicals:
In the agricultural sector, 3-chloro-2,6-dimethylaniline serves as a precursor for the synthesis of various agrochemicals, such as pesticides and herbicides, which are essential for crop protection and increased yield.
Used in Polymer Industry:
The compound is also employed in the polymer industry as a monomer for the production of polymers with specific properties, such as resistance to heat, chemicals, and UV radiation.
Check Digit Verification of cas no
The CAS Registry Mumber 26829-77-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,2 and 9 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 26829-77:
(7*2)+(6*6)+(5*8)+(4*2)+(3*9)+(2*7)+(1*7)=146
146 % 10 = 6
So 26829-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN/c1-5-3-4-7(9)6(2)8(5)10/h3-4H,10H2,1-2H3
