26830-40-0 Usage
Uses
Used in Pharmaceutical Research and Development:
2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDROTHIENO[2,3-C]PYRIDINE-3-CARBONITRILE is used as a chemical compound in pharmaceutical research and development for its potential biological activity. Its unique structure may contribute to the discovery of new therapeutic agents or drug candidates.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDROTHIENO[2,3-C]PYRIDINE-3-CARBONITRILE is used as a starting material or intermediate in the synthesis of novel compounds with potential therapeutic applications. Its versatile functional groups allow for various chemical modifications to optimize pharmacological properties.
Used in Drug Design:
2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDROTHIENO[2,3-C]PYRIDINE-3-CARBONITRILE is utilized in drug design as a structural template for the development of new pharmaceutical agents. Its unique molecular framework may provide insights into the design of drugs targeting specific biological pathways or receptors.
Used in Biochemical Studies:
In biochemical research, 2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDROTHIENO[2,3-C]PYRIDINE-3-CARBONITRILE is used as a probe or tool compound to study the interactions between small molecules and biological targets, such as enzymes, receptors, or proteins. This can help in understanding the molecular mechanisms of action and potential applications in therapeutic interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 26830-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,3 and 0 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 26830-40:
(7*2)+(6*6)+(5*8)+(4*3)+(3*0)+(2*4)+(1*0)=110
110 % 10 = 0
So 26830-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3S/c1-7(2)14-4-3-8-9(5-12)11(13)15-10(8)6-14/h7H,3-4,6,13H2,1-2H3
