26830-40-0 Usage
General Description
2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDROTHIENO[2,3-C]PYRIDINE-3-CARBONITRILE is a chemical compound with a complex molecular structure. It contains a six-membered thienopyridine ring fused to a tetrahydrofuran ring, with an isopropyl group attached to the nitrogen atom. Additionally, it contains an amino group and a nitrile functional group. 2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDROTHIENO[2,3-C]PYRIDINE-3-CARBONITRILE has potential applications in pharmaceutical research and development, due to its unique structure and potential biological activity. Its precise chemical properties and potential uses would require further investigation and testing in a laboratory setting.
Check Digit Verification of cas no
The CAS Registry Mumber 26830-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,3 and 0 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 26830-40:
(7*2)+(6*6)+(5*8)+(4*3)+(3*0)+(2*4)+(1*0)=110
110 % 10 = 0
So 26830-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3S/c1-7(2)14-4-3-8-9(5-12)11(13)15-10(8)6-14/h7H,3-4,6,13H2,1-2H3
