26846-98-0 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-4,5,6,7-TETRAHYDRO-1,3-BENZOTHIAZOLE is used as a key intermediate for the synthesis of various pharmaceutical drugs. Its high reactivity allows for the creation of complex chemical entities that can be utilized in the development of new medications.
Used in Organic Synthesis:
2-CHLORO-4,5,6,7-TETRAHYDRO-1,3-BENZOTHIAZOLE is used as a reactive component in organic synthesis, particularly in chemical reactions that require the formation of new bonds or the modification of existing ones. Its presence in these reactions can lead to the production of novel compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 26846-98-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,4 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26846-98:
(7*2)+(6*6)+(5*8)+(4*4)+(3*6)+(2*9)+(1*8)=150
150 % 10 = 0
So 26846-98-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H8ClNS/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H2
